C24H29NO3 — CID 119071469
N-(2,2-dimethyloxan-4-yl)-N-methyl-3-(3-propanoylphenyl)benzamide (PubChem CID 119071469) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-N-methyl-3-(3-propanoylphenyl)benzamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-N-methyl-3-(3-propanoylphenyl)benzamide |
|---|---|
| PubChem CID | 119071469 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-N-methyl-3-(3-propanoylphenyl)benzamide |
| SMILES | CCC(=O)c1cccc(-c2cccc(C(=O)N(C)C3CCOC(C)(C)C3)c2)c1 |
| InChI | InChI=1S/C24H29NO3/c1-5-22(26)19-10-6-8-17(14-19)18-9-7-11-20(15-18)23(27)25(4)21-12-13-28-24(2,3)16-21/h6-11,14-15,21H,5,12-13,16H2,1-4H3 |
| InChIKey | INUYRSHTHOLBGP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |