C23H28N2O2 — CID 119071518
N-(2-methoxyethyl)-2-phenyl-N-(pyridin-4-ylmethyl)spiro[2.4]heptane-2-carboxamide (PubChem CID 119071518) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-phenyl-N-(pyridin-4-ylmethyl)spiro[2.4]heptane-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-phenyl-N-(pyridin-4-ylmethyl)spiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119071518 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(2-methoxyethyl)-2-phenyl-N-(pyridin-4-ylmethyl)spiro[2.4]heptane-2-carboxamide |
| SMILES | COCCN(Cc1ccncc1)C(=O)C1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C23H28N2O2/c1-27-16-15-25(17-19-9-13-24-14-10-19)21(26)23(20-7-3-2-4-8-20)18-22(23)11-5-6-12-22/h2-4,7-10,13-14H,5-6,11-12,15-18H2,1H3 |
| InChIKey | YWYOMFUBFNZVMV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |