C21H24N2O — CID 99970498
(2R)-2-phenyl-N-(2-pyridin-4-ylethyl)spiro[2.4]heptane-2-carboxamide (PubChem CID 99970498) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (2R)-2-phenyl-N-(2-pyridin-4-ylethyl)spiro[2.4]heptane-2-carboxamide.
| Compound Name | (2R)-2-phenyl-N-(2-pyridin-4-ylethyl)spiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 99970498 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (2R)-2-phenyl-N-(2-pyridin-4-ylethyl)spiro[2.4]heptane-2-carboxamide |
| SMILES | O=C(NCCc1ccncc1)[C@]1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C21H24N2O/c24-19(23-15-10-17-8-13-22-14-9-17)21(18-6-2-1-3-7-18)16-20(21)11-4-5-12-20/h1-3,6-9,13-14H,4-5,10-12,15-16H2,(H,23,24)/t21-/m1/s1 |
| InChIKey | BPRWIZQQZNBZSI-OAQYLSRUSA-N |
| XLogP | 3.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |