C19H23N3O3 — CID 126423833
(2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2-phenylspiro[2.4]heptane-2-carboxamide (PubChem CID 126423833) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2-phenylspiro[2.4]heptane-2-carboxamide.
| Compound Name | (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2-phenylspiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 126423833 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-2-phenylspiro[2.4]heptane-2-carboxamide |
| SMILES | Cc1nonc1OCCNC(=O)[C@@]1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C19H23N3O3/c1-14-16(22-25-21-14)24-12-11-20-17(23)19(15-7-3-2-4-8-15)13-18(19)9-5-6-10-18/h2-4,7-8H,5-6,9-13H2,1H3,(H,20,23)/t19-/m0/s1 |
| InChIKey | NDRCBLPPXCLELG-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|