C21H23N3O3 — CID 97273006
(3R)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(2-methylphenyl)-3-phenylpropanamide (PubChem CID 97273006) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3R)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(2-methylphenyl)-3-phenylpropanamide.
| Compound Name | (3R)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(2-methylphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 97273006 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (3R)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(2-methylphenyl)-3-phenylpropanamide |
| SMILES | Cc1ccccc1[C@H](CC(=O)NCCOc1nonc1C)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O3/c1-15-8-6-7-11-18(15)19(17-9-4-3-5-10-17)14-20(25)22-12-13-26-21-16(2)23-27-24-21/h3-11,19H,12-14H2,1-2H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | HAEPULGOAUKWJR-LJQANCHMSA-N |
| XLogP | 3.40 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|