C23H25N3O — CID 97282614
(3R)-3-(2-methylphenyl)-3-phenyl-N-[2-(pyridin-3-ylamino)ethyl]propanamide (PubChem CID 97282614) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (3R)-3-(2-methylphenyl)-3-phenyl-N-[2-(pyridin-3-ylamino)ethyl]propanamide.
| Compound Name | (3R)-3-(2-methylphenyl)-3-phenyl-N-[2-(pyridin-3-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 97282614 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (3R)-3-(2-methylphenyl)-3-phenyl-N-[2-(pyridin-3-ylamino)ethyl]propanamide |
| SMILES | Cc1ccccc1[C@H](CC(=O)NCCNc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3O/c1-18-8-5-6-12-21(18)22(19-9-3-2-4-10-19)16-23(27)26-15-14-25-20-11-7-13-24-17-20/h2-13,17,22,25H,14-16H2,1H3,(H,26,27)/t22-/m1/s1 |
| InChIKey | SLZJSLRFOMSCKQ-JOCHJYFZSA-N |
| XLogP | 4.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|