C19H23N3O — CID 126443610
(2R)-2-phenyl-N-[2-(1H-pyrazol-5-yl)ethyl]spiro[2.4]heptane-2-carboxamide (PubChem CID 126443610) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (2R)-2-phenyl-N-[2-(1H-pyrazol-5-yl)ethyl]spiro[2.4]heptane-2-carboxamide.
| Compound Name | (2R)-2-phenyl-N-[2-(1H-pyrazol-5-yl)ethyl]spiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 126443610 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (2R)-2-phenyl-N-[2-(1H-pyrazol-5-yl)ethyl]spiro[2.4]heptane-2-carboxamide |
| SMILES | O=C(NCCc1ccn[nH]1)[C@]1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C19H23N3O/c23-17(20-12-8-16-9-13-21-22-16)19(15-6-2-1-3-7-15)14-18(19)10-4-5-11-18/h1-3,6-7,9,13H,4-5,8,10-12,14H2,(H,20,23)(H,21,22)/t19-/m1/s1 |
| InChIKey | ZMJRGQBCTLJIKT-LJQANCHMSA-N |
| XLogP | 2.97 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |