C18H22N4OS — CID 119066000
2-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]spiro[2.4]heptane-2-carboxamide (PubChem CID 119066000) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]spiro[2.4]heptane-2-carboxamide.
| Compound Name | 2-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]spiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119066000 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-phenyl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]spiro[2.4]heptane-2-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)C1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C18H22N4OS/c23-16(19-10-11-24-15-12-20-22-21-15)18(14-6-2-1-3-7-14)13-17(18)8-4-5-9-17/h1-3,6-7,12H,4-5,8-11,13H2,(H,19,23)(H,20,21,22) |
| InChIKey | TWBOEZZBJPPBKI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|