C20H27NO2 — CID 126423700
(2R)-N-[1-(hydroxymethyl)cyclopentyl]-2-phenylspiro[2.4]heptane-2-carboxamide (PubChem CID 126423700) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (2R)-N-[1-(hydroxymethyl)cyclopentyl]-2-phenylspiro[2.4]heptane-2-carboxamide.
| Compound Name | (2R)-N-[1-(hydroxymethyl)cyclopentyl]-2-phenylspiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 126423700 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2R)-N-[1-(hydroxymethyl)cyclopentyl]-2-phenylspiro[2.4]heptane-2-carboxamide |
| SMILES | O=C(NC1(CO)CCCC1)[C@]1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C20H27NO2/c22-15-19(12-6-7-13-19)21-17(23)20(16-8-2-1-3-9-16)14-18(20)10-4-5-11-18/h1-3,8-9,22H,4-7,10-15H2,(H,21,23)/t20-/m1/s1 |
| InChIKey | ZNNDGSUITSPIPB-HXUWFJFHSA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |