C18H17Cl2NO — CID 2832401
2,2-dichloro-1-phenyl-N-(2-phenylethyl)cyclopropane-1-carboxamide (PubChem CID 2832401) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is 2,2-dichloro-1-phenyl-N-(2-phenylethyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-phenyl-N-(2-phenylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2832401 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2,2-dichloro-1-phenyl-N-(2-phenylethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C18H17Cl2NO/c19-18(20)13-17(18,15-9-5-2-6-10-15)16(22)21-12-11-14-7-3-1-4-8-14/h1-10H,11-13H2,(H,21,22) |
| InChIKey | MRHIZGABXJUOFN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|