About N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide
N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide (PubChem CID 119072623) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide.
Molecular Properties
| Compound Name | N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide |
| PubChem CID | 119072623 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide |
| SMILES | CCOC(C)C(=O)NCCn1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C13H21N3O3/c1-5-19-11(4)12(17)14-6-7-16-10(3)8-9(2)15-13(16)18/h8,11H,5-7H2,1-4H3,(H,14,17) |
| InChIKey | WLLKBNITUQPNCW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide?
The IUPAC name of N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide (CID 119072623) is N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide.
What is the SMILES notation for N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide?
The canonical SMILES for N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide is CCOC(C)C(=O)NCCn1c(C)cc(C)nc1=O.
What is the InChIKey of N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide?
The InChIKey is WLLKBNITUQPNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-5-19-11(4)12(17)14-6-7-16-10(3)8-9(2)15-13(16)18/h8,11H,5-7H2,1-4H3,(H,14,17).
What are the key properties of N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide?
N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide has a molecular weight of 267.33 g/mol, XLogP of 0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl]-2-ethoxypropanamide is sourced from PubChem (CID 119072623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).