C20H27N5O — CID 119073733
1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-2-(triazol-1-yl)ethanone (PubChem CID 119073733) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-2-(triazol-1-yl)ethanone.
| Compound Name | 1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-2-(triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 119073733 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-2-(triazol-1-yl)ethanone |
| SMILES | O=C(Cn1ccnn1)N1CCCC2(CCCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C20H27N5O/c26-19(15-25-13-10-21-22-25)24-12-5-9-20(17-24)8-4-11-23(16-20)14-18-6-2-1-3-7-18/h1-3,6-7,10,13H,4-5,8-9,11-12,14-17H2 |
| InChIKey | VXCNAJDKWBXQRA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |