C23H32N4O — CID 70767519
1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-4-imidazol-1-ylbutan-1-one (PubChem CID 70767519) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-4-imidazol-1-ylbutan-1-one.
| Compound Name | 1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-4-imidazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 70767519 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 1-(8-benzyl-2,8-diazaspiro[5.5]undecan-2-yl)-4-imidazol-1-ylbutan-1-one |
| SMILES | O=C(CCCn1ccnc1)N1CCCC2(CCCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C23H32N4O/c28-22(9-4-13-25-16-12-24-20-25)27-15-6-11-23(19-27)10-5-14-26(18-23)17-21-7-2-1-3-8-21/h1-3,7-8,12,16,20H,4-6,9-11,13-15,17-19H2 |
| InChIKey | KNWQXOONRIUOLZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |