C21H28N4O — CID 95885755
(6R)-2-benzyl-8-(2-imidazol-1-ylethyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 95885755) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is (6R)-2-benzyl-8-(2-imidazol-1-ylethyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6R)-2-benzyl-8-(2-imidazol-1-ylethyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 95885755 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (6R)-2-benzyl-8-(2-imidazol-1-ylethyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | O=C1CC[C@@]2(CCCN(CCn3ccnc3)C2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C21H28N4O/c26-20-7-9-21(17-25(20)15-19-5-2-1-3-6-19)8-4-11-23(16-21)13-14-24-12-10-22-18-24/h1-3,5-6,10,12,18H,4,7-9,11,13-17H2/t21-/m1/s1 |
| InChIKey | BOGNKYMVCFINEC-OAQYLSRUSA-N |
| XLogP | 2.79 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |