C22H33N3O2 — CID 70739252
2-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)-N-tert-butylacetamide (PubChem CID 70739252) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)-N-tert-butylacetamide.
| Compound Name | 2-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)-N-tert-butylacetamide |
|---|---|
| PubChem CID | 70739252 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-(2-benzyl-3-oxo-2,8-diazaspiro[5.5]undecan-8-yl)-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCCC2(CCC(=O)N(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-21(2,3)23-19(26)15-24-13-7-11-22(16-24)12-10-20(27)25(17-22)14-18-8-5-4-6-9-18/h4-6,8-9H,7,10-17H2,1-3H3,(H,23,26) |
| InChIKey | ZRBUMAKRHZXAPX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |