C19H29N3O — CID 70745912
8-butyl-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 70745912) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 8-butyl-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 8-butyl-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70745912 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 8-butyl-2-(pyridin-4-ylmethyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCCCN1CCCC2(CCC(=O)N(Cc3ccncc3)C2)C1 |
| InChI | InChI=1S/C19H29N3O/c1-2-3-12-21-13-4-8-19(15-21)9-5-18(23)22(16-19)14-17-6-10-20-11-7-17/h6-7,10-11H,2-5,8-9,12-16H2,1H3 |
| InChIKey | AEXWPFOOAVKKHX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |