C18H25N3O3 — CID 119073913
N-(2-ethyl-2,5-dihydroxypentyl)-3-(1-methylpyrazol-4-yl)benzamide (PubChem CID 119073913) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(2-ethyl-2,5-dihydroxypentyl)-3-(1-methylpyrazol-4-yl)benzamide.
| Compound Name | N-(2-ethyl-2,5-dihydroxypentyl)-3-(1-methylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 119073913 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-(2-ethyl-2,5-dihydroxypentyl)-3-(1-methylpyrazol-4-yl)benzamide |
| SMILES | CCC(O)(CCCO)CNC(=O)c1cccc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C18H25N3O3/c1-3-18(24,8-5-9-22)13-19-17(23)15-7-4-6-14(10-15)16-11-20-21(2)12-16/h4,6-7,10-12,22,24H,3,5,8-9,13H2,1-2H3,(H,19,23) |
| InChIKey | MLIPXSSKAWOIQG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |