C19H22FNO3 — CID 125167425
N-[(2S)-2,5-dihydroxy-2-methylpentyl]-3-(4-fluorophenyl)benzamide (PubChem CID 125167425) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[(2S)-2,5-dihydroxy-2-methylpentyl]-3-(4-fluorophenyl)benzamide.
| Compound Name | N-[(2S)-2,5-dihydroxy-2-methylpentyl]-3-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 125167425 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[(2S)-2,5-dihydroxy-2-methylpentyl]-3-(4-fluorophenyl)benzamide |
| SMILES | C[C@](O)(CCCO)CNC(=O)c1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H22FNO3/c1-19(24,10-3-11-22)13-21-18(23)16-5-2-4-15(12-16)14-6-8-17(20)9-7-14/h2,4-9,12,22,24H,3,10-11,13H2,1H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | HNDITYUOAYJREZ-IBGZPJMESA-N |
| XLogP | 2.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |