C19H25N3O3 — CID 125174711
N-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-(3,6-dimethylpyrazin-2-yl)benzamide (PubChem CID 125174711) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-(3,6-dimethylpyrazin-2-yl)benzamide.
| Compound Name | N-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-(3,6-dimethylpyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 125174711 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-(3,6-dimethylpyrazin-2-yl)benzamide |
| SMILES | Cc1cnc(C)c(-c2cccc(C(=O)NC[C@](C)(O)CCCO)c2)n1 |
| InChI | InChI=1S/C19H25N3O3/c1-13-11-20-14(2)17(22-13)15-6-4-7-16(10-15)18(24)21-12-19(3,25)8-5-9-23/h4,6-7,10-11,23,25H,5,8-9,12H2,1-3H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | GIAAIAPVBDUXBE-LJQANCHMSA-N |
| XLogP | 2.01 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |