C22H25N3O3 — CID 122559927
3-(4-aminoquinolin-8-yl)-N-(2,5-dihydroxy-2-methylpentyl)benzamide (PubChem CID 122559927) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-(4-aminoquinolin-8-yl)-N-(2,5-dihydroxy-2-methylpentyl)benzamide.
| Compound Name | 3-(4-aminoquinolin-8-yl)-N-(2,5-dihydroxy-2-methylpentyl)benzamide |
|---|---|
| PubChem CID | 122559927 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-(4-aminoquinolin-8-yl)-N-(2,5-dihydroxy-2-methylpentyl)benzamide |
| SMILES | CC(O)(CCCO)CNC(=O)c1cccc(-c2cccc3c(N)ccnc23)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-22(28,10-4-12-26)14-25-21(27)16-6-2-5-15(13-16)17-7-3-8-18-19(23)9-11-24-20(17)18/h2-3,5-9,11,13,26,28H,4,10,12,14H2,1H3,(H2,23,24)(H,25,27) |
| InChIKey | ZOICSUCVUBUKTG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |