C20H26N2O3 — CID 125169821
1-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-[4-(3-methylphenyl)phenyl]urea (PubChem CID 125169821) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-[4-(3-methylphenyl)phenyl]urea.
| Compound Name | 1-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-[4-(3-methylphenyl)phenyl]urea |
|---|---|
| PubChem CID | 125169821 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(2R)-2,5-dihydroxy-2-methylpentyl]-3-[4-(3-methylphenyl)phenyl]urea |
| SMILES | Cc1cccc(-c2ccc(NC(=O)NC[C@](C)(O)CCCO)cc2)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-15-5-3-6-17(13-15)16-7-9-18(10-8-16)22-19(24)21-14-20(2,25)11-4-12-23/h3,5-10,13,23,25H,4,11-12,14H2,1-2H3,(H2,21,22,24)/t20-/m1/s1 |
| InChIKey | UVOGYZXDSSDRSJ-HXUWFJFHSA-N |
| XLogP | 3.31 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |