C10H19NO — CID 119082377
3-tert-butyl-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 119082377) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-tert-butyl-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | 3-tert-butyl-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119082377 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-tert-butyl-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC(C)(C)C1C(C(N)=O)C1(C)C |
| InChI | InChI=1S/C10H19NO/c1-9(2,3)7-6(8(11)12)10(7,4)5/h6-7H,1-5H3,(H2,11,12) |
| InChIKey | YSJSVHTXRBHQRO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |