C5H3ClN2OS — CID 119083048
2-chloro-5-(isocyanatomethyl)-1,3-thiazole (PubChem CID 119083048) has the molecular formula C5H3ClN2OS and a molecular weight of 174.61 g/mol. Its IUPAC name is 2-chloro-5-(isocyanatomethyl)-1,3-thiazole.
| Compound Name | 2-chloro-5-(isocyanatomethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 119083048 |
| Molecular Formula | C5H3ClN2OS |
| Molecular Weight | 174.61 g/mol |
| Exact Mass | 173.97 |
| IUPAC Name | 2-chloro-5-(isocyanatomethyl)-1,3-thiazole |
| SMILES | O=C=NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C5H3ClN2OS/c6-5-8-2-4(10-5)1-7-3-9/h2H,1H2 |
| InChIKey | LKRSRMFOILDZPR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.61 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|