About (2-methylpyrimidin-4-yl) carbamate
(2-methylpyrimidin-4-yl) carbamate (PubChem CID 119083967) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is (2-methylpyrimidin-4-yl) carbamate.
Molecular Properties
| Compound Name | (2-methylpyrimidin-4-yl) carbamate |
| PubChem CID | 119083967 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | (2-methylpyrimidin-4-yl) carbamate |
| SMILES | Cc1nccc(OC(N)=O)n1 |
| InChI | InChI=1S/C6H7N3O2/c1-4-8-3-2-5(9-4)11-6(7)10/h2-3H,1H3,(H2,7,10) |
| InChIKey | AHIZMZGJFYVSDH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylpyrimidin-4-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrimidin-4-yl) carbamate?
The IUPAC name of (2-methylpyrimidin-4-yl) carbamate (CID 119083967) is (2-methylpyrimidin-4-yl) carbamate.
What is the SMILES notation for (2-methylpyrimidin-4-yl) carbamate?
The canonical SMILES for (2-methylpyrimidin-4-yl) carbamate is Cc1nccc(OC(N)=O)n1.
What is the InChIKey of (2-methylpyrimidin-4-yl) carbamate?
The InChIKey is AHIZMZGJFYVSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c1-4-8-3-2-5(9-4)11-6(7)10/h2-3H,1H3,(H2,7,10).
What are the key properties of (2-methylpyrimidin-4-yl) carbamate?
(2-methylpyrimidin-4-yl) carbamate has a molecular weight of 153.14 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrimidin-4-yl) carbamate is sourced from PubChem (CID 119083967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).