About (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate
(2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate (PubChem CID 175337994) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate |
| PubChem CID | 175337994 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate |
| SMILES | Cc1nccc(OC(=O)C2CCCN2)n1 |
| InChI | InChI=1S/C10H13N3O2/c1-7-11-6-4-9(13-7)15-10(14)8-3-2-5-12-8/h4,6,8,12H,2-3,5H2,1H3 |
| InChIKey | QGHBZXVWYYWJID-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate?
The IUPAC name of (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate (CID 175337994) is (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate.
What is the SMILES notation for (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate?
The canonical SMILES for (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate is Cc1nccc(OC(=O)C2CCCN2)n1.
What is the InChIKey of (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate?
The InChIKey is QGHBZXVWYYWJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-7-11-6-4-9(13-7)15-10(14)8-3-2-5-12-8/h4,6,8,12H,2-3,5H2,1H3.
What are the key properties of (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate?
(2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrimidin-4-yl) pyrrolidine-2-carboxylate is sourced from PubChem (CID 175337994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).