C7H9ClN2O2 — CID 119086363
2-[(dimethylamino)methyl]-1,3-oxazole-4-carbonyl chloride (PubChem CID 119086363) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1,3-oxazole-4-carbonyl chloride.
| Compound Name | 2-[(dimethylamino)methyl]-1,3-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 119086363 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1,3-oxazole-4-carbonyl chloride |
| SMILES | CN(C)Cc1nc(C(=O)Cl)co1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-10(2)3-6-9-5(4-12-6)7(8)11/h4H,3H2,1-2H3 |
| InChIKey | IFBMDODDVGBZRA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|