C13H10ClNO3 — CID 86664917
2-[(3-acetylphenyl)methyl]-1,3-oxazole-4-carbonyl chloride (PubChem CID 86664917) has the molecular formula C13H10ClNO3 and a molecular weight of 263.68 g/mol. Its IUPAC name is 2-[(3-acetylphenyl)methyl]-1,3-oxazole-4-carbonyl chloride.
| Compound Name | 2-[(3-acetylphenyl)methyl]-1,3-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 86664917 |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-[(3-acetylphenyl)methyl]-1,3-oxazole-4-carbonyl chloride |
| SMILES | CC(=O)c1cccc(Cc2nc(C(=O)Cl)co2)c1 |
| InChI | InChI=1S/C13H10ClNO3/c1-8(16)10-4-2-3-9(5-10)6-12-15-11(7-18-12)13(14)17/h2-5,7H,6H2,1H3 |
| InChIKey | VIKLWERJWBOSGY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|