C11H8N2O4S — CID 119087812
(4-nitrophenyl) 2-(1,2-thiazol-5-yl)acetate (PubChem CID 119087812) has the molecular formula C11H8N2O4S and a molecular weight of 264.26 g/mol. Its IUPAC name is (4-nitrophenyl) 2-(1,2-thiazol-5-yl)acetate.
| Compound Name | (4-nitrophenyl) 2-(1,2-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 119087812 |
| Molecular Formula | C11H8N2O4S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | (4-nitrophenyl) 2-(1,2-thiazol-5-yl)acetate |
| SMILES | O=C(Cc1ccns1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H8N2O4S/c14-11(7-10-5-6-12-18-10)17-9-3-1-8(2-4-9)13(15)16/h1-6H,7H2 |
| InChIKey | BYTMTKDUBXGFHK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|