About quinazoline-2-sulfonyl fluoride
quinazoline-2-sulfonyl fluoride (PubChem CID 119090579) has the molecular formula C8H5FN2O2S
and a molecular weight of 212.21 g/mol. Its IUPAC name is quinazoline-2-sulfonyl fluoride.
Molecular Properties
| Compound Name | quinazoline-2-sulfonyl fluoride |
| PubChem CID | 119090579 |
| Molecular Formula | C8H5FN2O2S |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | quinazoline-2-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ncc2ccccc2n1 |
| InChI | InChI=1S/C8H5FN2O2S/c9-14(12,13)8-10-5-6-3-1-2-4-7(6)11-8/h1-5H |
| InChIKey | BNBSXJBEEVDMCQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze quinazoline-2-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazoline-2-sulfonyl fluoride?
The IUPAC name of quinazoline-2-sulfonyl fluoride (CID 119090579) is quinazoline-2-sulfonyl fluoride.
What is the SMILES notation for quinazoline-2-sulfonyl fluoride?
The canonical SMILES for quinazoline-2-sulfonyl fluoride is O=S(=O)(F)c1ncc2ccccc2n1.
What is the InChIKey of quinazoline-2-sulfonyl fluoride?
The InChIKey is BNBSXJBEEVDMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2O2S/c9-14(12,13)8-10-5-6-3-1-2-4-7(6)11-8/h1-5H.
What are the key properties of quinazoline-2-sulfonyl fluoride?
quinazoline-2-sulfonyl fluoride has a molecular weight of 212.21 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinazoline-2-sulfonyl fluoride is sourced from PubChem (CID 119090579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).