About 2-pyrimidin-5-ylfuro[3,2-b]pyridine
2-pyrimidin-5-ylfuro[3,2-b]pyridine (PubChem CID 119090842) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-pyrimidin-5-ylfuro[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-pyrimidin-5-ylfuro[3,2-b]pyridine |
| PubChem CID | 119090842 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-pyrimidin-5-ylfuro[3,2-b]pyridine |
| SMILES | c1cnc2cc(-c3cncnc3)oc2c1 |
| InChI | InChI=1S/C11H7N3O/c1-2-10-9(14-3-1)4-11(15-10)8-5-12-7-13-6-8/h1-7H |
| InChIKey | CNSYYFRTJHOJMV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrimidin-5-ylfuro[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-5-ylfuro[3,2-b]pyridine?
The IUPAC name of 2-pyrimidin-5-ylfuro[3,2-b]pyridine (CID 119090842) is 2-pyrimidin-5-ylfuro[3,2-b]pyridine.
What is the SMILES notation for 2-pyrimidin-5-ylfuro[3,2-b]pyridine?
The canonical SMILES for 2-pyrimidin-5-ylfuro[3,2-b]pyridine is c1cnc2cc(-c3cncnc3)oc2c1.
What is the InChIKey of 2-pyrimidin-5-ylfuro[3,2-b]pyridine?
The InChIKey is CNSYYFRTJHOJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c1-2-10-9(14-3-1)4-11(15-10)8-5-12-7-13-6-8/h1-7H.
What are the key properties of 2-pyrimidin-5-ylfuro[3,2-b]pyridine?
2-pyrimidin-5-ylfuro[3,2-b]pyridine has a molecular weight of 197.20 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-5-ylfuro[3,2-b]pyridine is sourced from PubChem (CID 119090842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).