C9H10N2O2 — CID 84767584
N-(furo[3,2-b]pyridin-2-ylmethyl)-N-methylhydroxylamine (PubChem CID 84767584) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is N-(furo[3,2-b]pyridin-2-ylmethyl)-N-methylhydroxylamine.
| Compound Name | N-(furo[3,2-b]pyridin-2-ylmethyl)-N-methylhydroxylamine |
|---|---|
| PubChem CID | 84767584 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N-(furo[3,2-b]pyridin-2-ylmethyl)-N-methylhydroxylamine |
| SMILES | CN(O)Cc1cc2ncccc2o1 |
| InChI | InChI=1S/C9H10N2O2/c1-11(12)6-7-5-8-9(13-7)3-2-4-10-8/h2-5,12H,6H2,1H3 |
| InChIKey | IPSHUQVFWXHOGQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|