C8H7NOS2 — CID 119091655
7-methylsulfanyl-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 119091655) has the molecular formula C8H7NOS2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 7-methylsulfanyl-5H-thieno[3,2-c]pyridin-4-one.
| Compound Name | 7-methylsulfanyl-5H-thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 119091655 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 7-methylsulfanyl-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | CSc1c[nH]c(=O)c2ccsc12 |
| InChI | InChI=1S/C8H7NOS2/c1-11-6-4-9-8(10)5-2-3-12-7(5)6/h2-4H,1H3,(H,9,10) |
| InChIKey | GONJITXKQIVSCW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |