C15H12ClNOS2 — CID 135386544
4-[2-(4-chlorophenyl)ethylsulfanyl]-6H-thieno[2,3-c]pyridin-7-one (PubChem CID 135386544) has the molecular formula C15H12ClNOS2 and a molecular weight of 321.85 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethylsulfanyl]-6H-thieno[2,3-c]pyridin-7-one.
| Compound Name | 4-[2-(4-chlorophenyl)ethylsulfanyl]-6H-thieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 135386544 |
| Molecular Formula | C15H12ClNOS2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethylsulfanyl]-6H-thieno[2,3-c]pyridin-7-one |
| SMILES | O=c1[nH]cc(SCCc2ccc(Cl)cc2)c2ccsc12 |
| InChI | InChI=1S/C15H12ClNOS2/c16-11-3-1-10(2-4-11)5-7-19-13-9-17-15(18)14-12(13)6-8-20-14/h1-4,6,8-9H,5,7H2,(H,17,18) |
| InChIKey | ZHCRCDMKAOMBBJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |