C12H14Br2O2 — CID 119094647
2,3-dibromo-3-(2,3-dihydro-1H-inden-5-yloxy)propan-1-ol (PubChem CID 119094647) has the molecular formula C12H14Br2O2 and a molecular weight of 350.05 g/mol. Its IUPAC name is 2,3-dibromo-3-(2,3-dihydro-1H-inden-5-yloxy)propan-1-ol.
| Compound Name | 2,3-dibromo-3-(2,3-dihydro-1H-inden-5-yloxy)propan-1-ol |
|---|---|
| PubChem CID | 119094647 |
| Molecular Formula | C12H14Br2O2 |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 2,3-dibromo-3-(2,3-dihydro-1H-inden-5-yloxy)propan-1-ol |
| SMILES | OCC(Br)C(Br)Oc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H14Br2O2/c13-11(7-15)12(14)16-10-5-4-8-2-1-3-9(8)6-10/h4-6,11-12,15H,1-3,7H2 |
| InChIKey | OKQXIQGFQURBAP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|