About S-(3-phenoxypropyl) N-methylcarbamothioate
S-(3-phenoxypropyl) N-methylcarbamothioate (PubChem CID 119094845) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is S-(3-phenoxypropyl) N-methylcarbamothioate.
Molecular Properties
| Compound Name | S-(3-phenoxypropyl) N-methylcarbamothioate |
| PubChem CID | 119094845 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | S-(3-phenoxypropyl) N-methylcarbamothioate |
| SMILES | CNC(=O)SCCCOc1ccccc1 |
| InChI | InChI=1S/C11H15NO2S/c1-12-11(13)15-9-5-8-14-10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,12,13) |
| InChIKey | BZCVZJCGTWJWIE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-phenoxypropyl) N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-phenoxypropyl) N-methylcarbamothioate?
The IUPAC name of S-(3-phenoxypropyl) N-methylcarbamothioate (CID 119094845) is S-(3-phenoxypropyl) N-methylcarbamothioate.
What is the SMILES notation for S-(3-phenoxypropyl) N-methylcarbamothioate?
The canonical SMILES for S-(3-phenoxypropyl) N-methylcarbamothioate is CNC(=O)SCCCOc1ccccc1.
What is the InChIKey of S-(3-phenoxypropyl) N-methylcarbamothioate?
The InChIKey is BZCVZJCGTWJWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-12-11(13)15-9-5-8-14-10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,12,13).
What are the key properties of S-(3-phenoxypropyl) N-methylcarbamothioate?
S-(3-phenoxypropyl) N-methylcarbamothioate has a molecular weight of 225.31 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-phenoxypropyl) N-methylcarbamothioate is sourced from PubChem (CID 119094845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).