About S-(4-phenoxybutyl) azepane-1-carbothioate
S-(4-phenoxybutyl) azepane-1-carbothioate (PubChem CID 88729117) has the molecular formula C17H25NO2S
and a molecular weight of 307.46 g/mol. Its IUPAC name is S-(4-phenoxybutyl) azepane-1-carbothioate.
Molecular Properties
| Compound Name | S-(4-phenoxybutyl) azepane-1-carbothioate |
| PubChem CID | 88729117 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | S-(4-phenoxybutyl) azepane-1-carbothioate |
| SMILES | O=C(SCCCCOc1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C17H25NO2S/c19-17(18-12-6-1-2-7-13-18)21-15-9-8-14-20-16-10-4-3-5-11-16/h3-5,10-11H,1-2,6-9,12-15H2 |
| InChIKey | MSZCXSQPFODBJT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-phenoxybutyl) azepane-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-phenoxybutyl) azepane-1-carbothioate?
The IUPAC name of S-(4-phenoxybutyl) azepane-1-carbothioate (CID 88729117) is S-(4-phenoxybutyl) azepane-1-carbothioate.
What is the SMILES notation for S-(4-phenoxybutyl) azepane-1-carbothioate?
The canonical SMILES for S-(4-phenoxybutyl) azepane-1-carbothioate is O=C(SCCCCOc1ccccc1)N1CCCCCC1.
What is the InChIKey of S-(4-phenoxybutyl) azepane-1-carbothioate?
The InChIKey is MSZCXSQPFODBJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2S/c19-17(18-12-6-1-2-7-13-18)21-15-9-8-14-20-16-10-4-3-5-11-16/h3-5,10-11H,1-2,6-9,12-15H2.
What are the key properties of S-(4-phenoxybutyl) azepane-1-carbothioate?
S-(4-phenoxybutyl) azepane-1-carbothioate has a molecular weight of 307.46 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-phenoxybutyl) azepane-1-carbothioate is sourced from PubChem (CID 88729117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).