C5H13N3O4S3 — CID 119096682
N-methyl-2,2-bis(methylsulfamoyl)ethanethioamide (PubChem CID 119096682) has the molecular formula C5H13N3O4S3 and a molecular weight of 275.38 g/mol. Its IUPAC name is N-methyl-2,2-bis(methylsulfamoyl)ethanethioamide.
| Compound Name | N-methyl-2,2-bis(methylsulfamoyl)ethanethioamide |
|---|---|
| PubChem CID | 119096682 |
| Molecular Formula | C5H13N3O4S3 |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | N-methyl-2,2-bis(methylsulfamoyl)ethanethioamide |
| SMILES | CNC(=S)C(S(=O)(=O)NC)S(=O)(=O)NC |
| InChI | InChI=1S/C5H13N3O4S3/c1-6-4(13)5(14(9,10)7-2)15(11,12)8-3/h5,7-8H,1-3H3,(H,6,13) |
| InChIKey | QWVIDRYGXOIIJK-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|