C21H21N3O4S — CID 119105556
(4-benzylsulfonylpiperidin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone (PubChem CID 119105556) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is (4-benzylsulfonylpiperidin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | (4-benzylsulfonylpiperidin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 119105556 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (4-benzylsulfonylpiperidin-1-yl)-(5-pyridin-3-yl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2cccnc2)on1)N1CCC(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21N3O4S/c25-21(19-13-20(28-23-19)17-7-4-10-22-14-17)24-11-8-18(9-12-24)29(26,27)15-16-5-2-1-3-6-16/h1-7,10,13-14,18H,8-9,11-12,15H2 |
| InChIKey | AVHJEJCIBANGEO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |