C13H13N3O2S — CID 87019769
(5-pyridin-3-yl-1,2-oxazol-3-yl)-thiomorpholin-4-ylmethanone (PubChem CID 87019769) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is (5-pyridin-3-yl-1,2-oxazol-3-yl)-thiomorpholin-4-ylmethanone.
| Compound Name | (5-pyridin-3-yl-1,2-oxazol-3-yl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 87019769 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (5-pyridin-3-yl-1,2-oxazol-3-yl)-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1cc(-c2cccnc2)on1)N1CCSCC1 |
| InChI | InChI=1S/C13H13N3O2S/c17-13(16-4-6-19-7-5-16)11-8-12(18-15-11)10-2-1-3-14-9-10/h1-3,8-9H,4-7H2 |
| InChIKey | JKHSNSYCHUUVOL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |