C16H16BrF2NO3 — CID 119107226
5-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]-2-methoxyphenol (PubChem CID 119107226) has the molecular formula C16H16BrF2NO3 and a molecular weight of 388.21 g/mol. Its IUPAC name is 5-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 119107226 |
| Molecular Formula | C16H16BrF2NO3 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 5-[[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNCc2cc(Br)ccc2OC(F)F)cc1O |
| InChI | InChI=1S/C16H16BrF2NO3/c1-22-15-4-2-10(6-13(15)21)8-20-9-11-7-12(17)3-5-14(11)23-16(18)19/h2-7,16,20-21H,8-9H2,1H3 |
| InChIKey | ZYOPVGBKHBSYNW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |