C17H28NO+ — CID 11911053
(2R,4S,5S)-1,2,5-trimethyl-4-(2,4,6-trimethylphenyl)piperidin-1-ium-4-ol (PubChem CID 11911053) has the molecular formula C17H28NO+ and a molecular weight of 262.42 g/mol. Its IUPAC name is (2R,4S,5S)-1,2,5-trimethyl-4-(2,4,6-trimethylphenyl)piperidin-1-ium-4-ol.
| Compound Name | (2R,4S,5S)-1,2,5-trimethyl-4-(2,4,6-trimethylphenyl)piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 11911053 |
| Molecular Formula | C17H28NO+ |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | (2R,4S,5S)-1,2,5-trimethyl-4-(2,4,6-trimethylphenyl)piperidin-1-ium-4-ol |
| SMILES | Cc1cc(C)c([C@]2(O)C[C@@H](C)[NH+](C)C[C@@H]2C)c(C)c1 |
| InChI | InChI=1S/C17H27NO/c1-11-7-12(2)16(13(3)8-11)17(19)9-15(5)18(6)10-14(17)4/h7-8,14-15,19H,9-10H2,1-6H3/p+1/t14-,15+,17-/m0/s1 |
| InChIKey | OCNITLGAMZJUSH-UXLLHSPISA-O |
| XLogP | 1.74 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |