C17H19F3N2O2S — CID 119113191
N,N-dimethyl-4-[1-[(3,4,5-trifluorophenyl)methylamino]ethyl]benzenesulfonamide (PubChem CID 119113191) has the molecular formula C17H19F3N2O2S and a molecular weight of 372.41 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-[(3,4,5-trifluorophenyl)methylamino]ethyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[1-[(3,4,5-trifluorophenyl)methylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119113191 |
| Molecular Formula | C17H19F3N2O2S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N,N-dimethyl-4-[1-[(3,4,5-trifluorophenyl)methylamino]ethyl]benzenesulfonamide |
| SMILES | CC(NCc1cc(F)c(F)c(F)c1)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H19F3N2O2S/c1-11(21-10-12-8-15(18)17(20)16(19)9-12)13-4-6-14(7-5-13)25(23,24)22(2)3/h4-9,11,21H,10H2,1-3H3 |
| InChIKey | HADBZEHLOIAGLS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|