C19H21N7O — CID 119116898
2-methyl-1-[2-(2-oxo-3H-indol-1-yl)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 119116898) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-oxo-3H-indol-1-yl)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(2-oxo-3H-indol-1-yl)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119116898 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-methyl-1-[2-(2-oxo-3H-indol-1-yl)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCN1C(=O)Cc2ccccc21)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H21N7O/c1-20-19(22-13-17-24-23-16-8-4-5-10-26(16)17)21-9-11-25-15-7-3-2-6-14(15)12-18(25)27/h2-8,10H,9,11-13H2,1H3,(H2,20,21,22) |
| InChIKey | BWEOWYUGLHXTDD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|