C20H27N3OS — CID 119123788
4-[3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)ethylamino]methyl]phenoxy]butanenitrile (PubChem CID 119123788) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 4-[3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)ethylamino]methyl]phenoxy]butanenitrile.
| Compound Name | 4-[3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)ethylamino]methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 119123788 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-[3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)ethylamino]methyl]phenoxy]butanenitrile |
| SMILES | CC(C)(C)c1csc(CCNCc2cccc(OCCCC#N)c2)n1 |
| InChI | InChI=1S/C20H27N3OS/c1-20(2,3)18-15-25-19(23-18)9-11-22-14-16-7-6-8-17(13-16)24-12-5-4-10-21/h6-8,13,15,22H,4-5,9,11-12,14H2,1-3H3 |
| InChIKey | DVCZKWGIKPAMEI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|