C22H30N4O4 — CID 11912413
ethyl 3-[[(3R,4S)-4-[2-[cyanomethyl(methyl)amino]-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate (PubChem CID 11912413) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is ethyl 3-[[(3R,4S)-4-[2-[cyanomethyl(methyl)amino]-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[(3R,4S)-4-[2-[cyanomethyl(methyl)amino]-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 11912413 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | ethyl 3-[[(3R,4S)-4-[2-[cyanomethyl(methyl)amino]-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)N2CC[C@@H](CC(=O)N(C)CC#N)[C@@H](CC)C2)c1 |
| InChI | InChI=1S/C22H30N4O4/c1-4-16-15-26(11-9-17(16)14-20(27)25(3)12-10-23)22(29)24-19-8-6-7-18(13-19)21(28)30-5-2/h6-8,13,16-17H,4-5,9,11-12,14-15H2,1-3H3,(H,24,29)/t16-,17-/m0/s1 |
| InChIKey | AIJJJJGLAUVJDW-IRXDYDNUSA-N |
| XLogP | 3.12 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|