C23H34N4O5 — CID 73147860
ethyl 3-[[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate (PubChem CID 73147860) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is ethyl 3-[[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 73147860 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | ethyl 3-[[4-[2-(2-acetamidoethylamino)-2-oxoethyl]-3-ethylpiperidine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)N2CCC(CC(=O)NCCNC(C)=O)C(CC)C2)c1 |
| InChI | InChI=1S/C23H34N4O5/c1-4-17-15-27(12-9-18(17)14-21(29)25-11-10-24-16(3)28)23(31)26-20-8-6-7-19(13-20)22(30)32-5-2/h6-8,13,17-18H,4-5,9-12,14-15H2,1-3H3,(H,24,28)(H,25,29)(H,26,31) |
| InChIKey | QYSQMWIIUAFFMI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|