C24H35N3O2 — CID 119125069
N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methylpiperazin-1-yl)propan-2-amine (PubChem CID 119125069) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methylpiperazin-1-yl)propan-2-amine.
| Compound Name | N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methylpiperazin-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 119125069 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | N-[(3-ethoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methylpiperazin-1-yl)propan-2-amine |
| SMILES | CCOc1cc(CNC(C)CN2CCN(C)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H35N3O2/c1-4-28-24-16-22(10-11-23(24)29-19-21-8-6-5-7-9-21)17-25-20(2)18-27-14-12-26(3)13-15-27/h5-11,16,20,25H,4,12-15,17-19H2,1-3H3 |
| InChIKey | VDEVMXVHJTTWOQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |