C20H28N2O3 — CID 119125137
2-[1-[2-oxo-2-[(1-phenylpyrrolidin-3-yl)amino]ethyl]cyclohexyl]acetic acid (PubChem CID 119125137) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[1-[2-oxo-2-[(1-phenylpyrrolidin-3-yl)amino]ethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-oxo-2-[(1-phenylpyrrolidin-3-yl)amino]ethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 119125137 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[1-[2-oxo-2-[(1-phenylpyrrolidin-3-yl)amino]ethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)NC2CCN(c3ccccc3)C2)CCCCC1 |
| InChI | InChI=1S/C20H28N2O3/c23-18(13-20(14-19(24)25)10-5-2-6-11-20)21-16-9-12-22(15-16)17-7-3-1-4-8-17/h1,3-4,7-8,16H,2,5-6,9-15H2,(H,21,23)(H,24,25) |
| InChIKey | CFPHUWPUHLPWQA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |