C22H30N2O4 — CID 132972613
2-[1-[2-(4-benzamidopiperidin-1-yl)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 132972613) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[1-[2-(4-benzamidopiperidin-1-yl)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(4-benzamidopiperidin-1-yl)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 132972613 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-[1-[2-(4-benzamidopiperidin-1-yl)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)N2CCC(NC(=O)c3ccccc3)CC2)CCCCC1 |
| InChI | InChI=1S/C22H30N2O4/c25-19(15-22(16-20(26)27)11-5-2-6-12-22)24-13-9-18(10-14-24)23-21(28)17-7-3-1-4-8-17/h1,3-4,7-8,18H,2,5-6,9-16H2,(H,23,28)(H,26,27) |
| InChIKey | PKPWMCUZSXQUSE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |