C16H31N3O3 — CID 11912553
(3R,4S)-3-ethyl-4-[2-(2-methoxyethylamino)-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 11912553) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-4-[2-(2-methoxyethylamino)-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | (3R,4S)-3-ethyl-4-[2-(2-methoxyethylamino)-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 11912553 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (3R,4S)-3-ethyl-4-[2-(2-methoxyethylamino)-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC[C@H]1CN(C(=O)NC(C)C)CC[C@H]1CC(=O)NCCOC |
| InChI | InChI=1S/C16H31N3O3/c1-5-13-11-19(16(21)18-12(2)3)8-6-14(13)10-15(20)17-7-9-22-4/h12-14H,5-11H2,1-4H3,(H,17,20)(H,18,21)/t13-,14-/m0/s1 |
| InChIKey | UXRSKXCUDUWFPV-KBPBESRZSA-N |
| XLogP | 1.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|